Approval: | ISO |
---|---|
IUPAC PIN: | 4-(2,4-dichlorophenoxy)butanoic acid |
IUPAC name: | 4-(2,4-dichlorophenoxy)butanoic acid 1979 Rules: 4-(2,4-dichlorophenoxy)butyric acid |
CAS name: | 4-(2,4-dichlorophenoxy)butanoic acid |
CAS Reg. No.: | 94-82-6 |
Formula: | C10H10Cl2O3 |
Activity: | herbicides (phenoxybutyric) |
Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example 2,4-DB-butyl [6753-24-8], 2,4-DB-dimethylammonium [2758-42-1], 2,4-DB-isoctyl [1320-15-6], 2,4-DB-potassium [19480-40-1], 2,4-DB-sodium [10433-59-7]. |
Structure: | |
Pronunciation: | too for dē bē Guide to British pronunciation |
InChIKey: | YIVXMZJTEQBPQO-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H10Cl2O3/c11-7-3-4-9(8(12)6-7)15-5-1-2-10(13)14/h3-4,6H,1-2,5H2,(H,13,14) |
A data sheet from the Compendium of Pesticide Common Names