Status: | ISO 765 (published) |
---|---|
IUPAC PIN: | [1,1′-biphenyl]-2-ol |
IUPAC name: | biphenyl-2-ol |
CAS name: | [1,1′-biphenyl]-2-ol |
CAS Reg. No.: | 90-43-7 |
Formula: | C12H10O |
Activity: | fungicides (unclassified fungicides) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. The Chinese name “联苯酚” has also been used in the literature, but it has no official status. The sodium salt is also considered by the International Organization for Standardization not to require a common name, see sodium o-phenylphenoxide [132-27-4]. |
Structure: | |
Pronunciation: | too fē-nīl-fē-nǒl Guide to British pronunciation |
InChIKey: | LLEMOWNGBBNAJR-UHFFFAOYSA-N |
InChI: | InChI=1S/C12H10O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9,13H |
A data sheet from the Compendium of Pesticide Common Names