Approval: | ISO common name not required |
---|---|
IUPAC PIN: | N-(3-methylbut-2-en-1-yl)-7H-purin-6-amine |
IUPAC name: | N-(3-methylbut-2-enyl)-7H-purin-6-amine 1979 Rules: N-(3-methylbut-2-enyl)adenine |
CAS name: | N-(3-methyl-2-buten-1-yl)-1H-purin-6-amine |
CAS Reg. No.: | 2365-40-4 |
Formula: | C10H13N5 |
Activity: | plant growth regulators (cytokinin) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. The name “enadenine” (烯腺嘌呤) is approved in China. |
Structure: | |
Pronunciation: | too ī pē Guide to British pronunciation |
InChIKey: | HYVABZIGRDEKCD-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H13N5/c1-7(2)3-4-11-9-8-10(13-5-12-8)15-6-14-9/h3,5-6H,4H2,1-2H3,(H2,11,12,13,14,15) |
A data sheet from the Compendium of Pesticide Common Names