Status: | ISO 765 (published) |
---|---|
IUPAC PIN: | 4-(2-hydroxyethyl)phenol |
IUPAC name: | 4-(2-hydroxyethyl)phenol 1979 Rules: 4-hydroxyphenethyl alcohol |
CAS name: | 4-hydroxybenzeneethanol |
CAS Reg. No.: | 501-94-0 |
Formula: | C8H10O2 |
Activity: | plant growth regulators (cytokinins) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | for hī-drǒk-sī-fěn-ē-thīl ǎl-ka-hǒl Guide to British pronunciation |
InChIKey: | YCCILVSKPBXVIP-UHFFFAOYSA-N |
InChI: | InChI=1S/C8H10O2/c9-6-5-7-1-3-8(10)4-2-7/h1-4,9-10H,5-6H2 |
A data sheet from the Compendium of Pesticide Common Names