Status: | ISO 765 (published) |
---|---|
IUPAC PIN: | benzyl benzoate |
IUPAC name: | benzyl benzoate |
CAS name: | phenylmethyl benzoate |
CAS Reg. No.: | 120-51-4 |
Formula: | C14H12O2 |
Activity: | acaricides (benzoic acid) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | běn-zīl běn-zō-āt Guide to British pronunciation |
InChIKey: | SESFRYSPDFLNCH-UHFFFAOYSA-N |
InChI: | InChI=1S/C14H12O2/c15-14(13-9-5-2-6-10-13)16-11-12-7-3-1-4-8-12/h1-10H,11H2 |
A data sheet from the Compendium of Pesticide Common Names