Status: | China |
---|---|
IUPAC PIN: | ethyl (2Ξ)-2-cyano-3-(methylsulfanyl)-3-(2-nitroanilino)prop-2-enoate |
IUPAC name: | ethyl (2EZ)-2-cyano-3-(methylthio)-3-(2-nitroanilino)prop-2-enoate 1979 Rules: ethyl (2EZ)-2-cyano-3-(methylthio)-3-(2-nitroanilino)acrylate |
CAS name: | ethyl 2-cyano-3-(methylthio)-3-[(2-nitrophenyl)amino]-2-propenoate |
CAS Reg. No.: | 226703-69-1 |
Formula: | C13H13N3O4S |
Activity: | virucides |
Notes: | There is no ISO common name for this substance; the name “bingqingxiao” (病氰硝) is approved in China. |
Structure: | |
Pronunciation: | Guide to British pronunciation |
InChIKey: | HDHSBOLYUDZKFK-UHFFFAOYSA-N |
InChI: | InChI=1S/C13H13N3O4S/c1-3-20-13(17)9(8-14)12(21-2)15-10-6-4-5-7-11(10)16(18)19/h4-7,15H,3H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names