Status: | ISO 765 (published) |
---|---|
IUPAC name: | disodium tetraborate decahydrate |
CAS name: | borax |
CAS Reg. No.: | 1303-96-4 |
Formula: | B4H20Na2O17 |
Activity: | herbicides (inorganic) insecticides (inorganic) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. In ISO 765-1976 the name “disodium tetraborate” was given as an alternative. The name “borax” is approved by the Weed Science Society of America. |
Structure: | |
Pronunciation: | bor-ǎks Guide to British pronunciation |
InChIKey: | CDMADVZSLOHIFP-UHFFFAOYSA-N |
InChI: | InChI=1S/B4O7.2Na.10H2O/c5-1-7-3-9-2(6)10-4(8-1)11-3;;;;;;;;;;;;/h;;;10*1H2/q-2;2*+1;;;;;;;;;; |
A data sheet from the Compendium of Pesticide Common Names