boric acid

Chinese: 硼酸French: acide borique (n.m.)Russian: борная кислота


Approval: ISO common name not required
IUPAC name: boric acid
2005 Rules:
trihydroxidoboron
CAS name: boric acid (H3BO3)
CAS Reg. No.: 10043-35-3
Formula: BH3O3
Activity: (inorganic)
Notes: This substance is considered by the International Organization for Standardization not to require a common name.
Structure: Structural formula of boric acid
Pronunciation: bor-ǐk ǎs-ǐd  Guide to British pronunciation
InChIKey: KGBXLFKZBHKPEV-UHFFFAOYSA-N
InChI: InChI=1S/BH3O3/c2-1(3)4/h2-4H

A data sheet from the Compendium of Pesticide Common Names