Status: | ISO 765 (published) |
---|---|
IUPAC name: | boric acid 2005 Rules: trihydroxidoboron |
CAS name: | boric acid (H3BO3) |
CAS Reg. No.: | 10043-35-3 |
Formula: | BH3O3 |
Activity: | (inorganic) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | bor-ǐk ǎs-ǐd Guide to British pronunciation |
InChIKey: | KGBXLFKZBHKPEV-UHFFFAOYSA-N |
InChI: | InChI=1S/BH3O3/c2-1(3)4/h2-4H |
A data sheet from the Compendium of Pesticide Common Names