Status: | China |
---|---|
IUPAC PIN: | (Ξ)-[3-(4-bromophenoxy)phenyl](cyano)methyl (2Ξ)-2-(4-chlorophenyl)-3-methylbutanoate |
IUPAC name: | (αRS)-3-(4-bromophenoxy)-α-cyanobenzyl (2RS)-2-(4-chlorophenyl)-3-methylbutyrate |
CAS name: | [3-(4-bromophenoxy)phenyl]cyanomethyl 4-chloro-α-(1-methylethyl)benzeneacetate |
CAS Reg. No.: | 65295-49-0 |
Formula: | C25H21BrClNO3 |
Activity: | insecticides (pyrethroid isovalerate ester) |
Notes: | There is no ISO common name for this substance; the name “brofenvalerate” (溴灭菊酯) is approved in China. |
Structure: | |
Pronunciation: | brō-fěn-vǎl-er-āt Guide to British pronunciation |
InChIKey: | MFJPBJVWUYEEPB-UHFFFAOYSA-N |
InChI: | InChI=1S/C25H21BrClNO3/c1-16(2)24(17-6-10-20(27)11-7-17)25(29)31-23(15-28)18-4-3-5-22(14-18)30-21-12-8-19(26)9-13-21/h3-14,16,23-24H,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names