Approval: | ISO common name not required |
---|---|
IUPAC PIN: | N-bromoacetamide |
IUPAC name: | N-bromoacetamide |
CAS name: | N-bromoacetamide |
CAS Reg. No.: | 79-15-2 |
Formula: | C2H4BrNO |
Activity: | molluscicides |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | brō-mō-a-sēt-a-mīd Guide to British pronunciation |
InChIKey: | VBTQNRFWXBXZQR-UHFFFAOYSA-N |
InChI: | InChI=1S/C2H4BrNO/c1-2(5)4-3/h1H3,(H,4,5) |
A data sheet from the Compendium of Pesticide Common Names