Approval: | ISO |
---|---|
IUPAC PIN: | reaction mixture containing approximately 75% rac-(2R)-3-(pentan-2-yl)phenyl methylcarbamate and approximately 25% 3-(pentan-3-yl)phenyl methylcarbamate |
IUPAC name: | reaction mixture containing approximately 75% (RS)-3-(1-methylbutyl)phenyl methylcarbamate and approximately 25% 3-(1-ethylpropyl)phenyl methylcarbamate |
CAS name: | 3-(1-ethylpropyl)phenyl N-methylcarbamate mixture with 3-(1-methylbutyl)phenyl N-methylcarbamate |
CAS Reg. No.: | 8065-36-9 |
Formula: | C13H19NO2 |
Activity: | insecticides (phenyl carbamate) |
Notes: | |
Structure: | |
Pronunciation: | bū-fěn-karb Guide to British pronunciation |
InChIKey: | 3-(1-ethylpropyl)phenyl methylcarbamate: SMSFWBAOKCZZBF-UHFFFAOYSA-N 3-(1-methylbutyl)phenyl methylcarbamate: LHTOXQCYXYXXEZ-UHFFFAOYSA-N |
InChI: | 3-(1-ethylpropyl)phenyl methylcarbamate: InChI=1S/C13H19NO2/c1-4-10(5-2)11-7-6-8-12(9-11)16-13(15)14-3/h6-10H,4-5H2,1-3H3,(H,14,15) 3-(1-methylbutyl)phenyl methylcarbamate: InChI=1S/C13H19NO2/c1-4-6-10(2)11-7-5-8-12(9-11)16-13(15)14-3/h5,7-10H,4,6H2,1-3H3,(H,14,15) |
A data sheet from the Compendium of Pesticide Common Names