Status: | ISO 765 (published) |
---|---|
IUPAC PIN: | rac-(2R)-butan-2-amine |
IUPAC name: | (2RS)-butan-2-amine 1979 Rules: (RS)-sec-butylamine |
CAS name: | 2-butanamine |
CAS Reg. No.: | 13952-84-6 |
Formula: | C4H11N |
Activity: | fungicides (aliphatic nitrogen) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | bū-tīl-a-mēn Guide to British pronunciation |
InChIKey: | BHRZNVHARXXAHW-UHFFFAOYSA-N |
InChI: | InChI=1S/C4H11N/c1-3-4(2)5/h4H,3,5H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names