Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | (2,3,6-trichlorophenyl)acetic acid |
IUPAC name: | (2,3,6-trichlorophenyl)acetic acid |
CAS name: | 2,3,6-trichlorobenzeneacetic acid |
CAS Reg. No.: | 85-34-7 |
Formula: | C8H5Cl3O2 |
Activity: | herbicides (phenylcarboxylic acid) |
Notes: | The name “fenac” is used in Canada and the USA. When this substance is used as an ester or a salt, its identity should be stated, for example chlorfenac-ammonium [53404-90-3], chlorfenac-sodium [2439-00-1]. |
Structure: | |
Pronunciation: | klor-fěn-ǎk Guide to British pronunciation |
InChIKey: | QZXCCPZJCKEPSA-UHFFFAOYSA-N |
InChI: | InChI=1S/C8H5Cl3O2/c9-5-1-2-6(10)8(11)4(5)3-7(12)13/h1-2H,3H2,(H,12,13) |
A data sheet from the Compendium of Pesticide Common Names