Approval: | ISO common name not required |
---|---|
IUPAC PIN: | trichloromethane |
IUPAC name: | chloroform |
CAS name: | trichloromethane |
CAS Reg. No.: | 67-66-3 |
Formula: | CHCl3 |
Activity: | insecticides (alkyl halide; fumigant) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | klor-a-form Guide to British pronunciation |
InChIKey: | HEDRZPFGACZZDS-UHFFFAOYSA-N |
InChI: | InChI=1S/CHCl3/c2-1(3)4/h1H |
A data sheet from the Compendium of Pesticide Common Names