Approval: | ISO |
---|---|
IUPAC PIN: | rac-2-[(2R)-(4-chlorophenyl)phenylacetyl]-1H-indene-1,3(2H)-dione |
IUPAC name: | 2-[(2RS)-(4-chlorophenyl)phenylacetyl]indane-1,3-dione 1979 Rules: 2-[(RS)-(4-chlorophenyl)phenylacetyl]indan-1,3-dione |
CAS name: | 2-[2-(4-chlorophenyl)-2-phenylacetyl]-1H-indene-1,3(2H)-dione |
CAS Reg. No.: | 3691-35-8 |
Formula: | C23H15ClO3 |
Activity: | rodenticides (indandione) |
Notes: | When this substance is used as a salt, its identity should be stated, for example chlorophacinone-sodium. |
Structure: | |
Pronunciation: | klor-ō-fǎs-ǐ-nōn Guide to British pronunciation |
InChIKey: | UDHXJZHVNHGCEC-UHFFFAOYSA-N |
InChI: | InChI=1S/C23H15ClO3/c24-16-12-10-15(11-13-16)19(14-6-2-1-3-7-14)23(27)20-21(25)17-8-4-5-9-18(17)22(20)26/h1-13,19-20H |
A data sheet from the Compendium of Pesticide Common Names