| Status: | none |
|---|---|
| IUPAC PIN: | 3,5-dichloro-2,6-dimethylpyridin-4-ol |
| IUPAC name: | 3,5-dichloro-2,6-dimethylpyridin-4-ol |
| CAS name: | 3,5-dichloro-2,6-dimethyl-4-pyridinol |
| CAS Reg. No.: | 2971-90-6 |
| Formula: | C7H7Cl2NO |
| Activity: | coccidiostat |
| Notes: | The name “clopindol” has been used in the literature, but it has no official status. The name “clopidol” is approved by the World Health Organization. |
| Structure: |  |
| Pronunciation: | klō-pǐn-dǒl Guide to British pronunciation |
| InChIKey: | ZDPIZLCVJAAHHR-UHFFFAOYSA-N |
| InChI: | InChI=1S/C7H7Cl2NO/c1-3-5(8)7(11)6(9)4(2)10-3/h1-2H3,(H,10,11) |