Status: | none |
---|---|
IUPAC PIN: | (5S,8R)-1-[(6-chloropyridin-3-yl)methyl]-9-nitro-2,3,5,6,7,8-hexahydro-1H-5,8-epoxyimidazo[1,2-a]azepine |
IUPAC name: | (5S,8R)-1-[(6-chloro-3-pyridyl)methyl]-2,3,5,6,7,8-hexahydro-9-nitro-1H-5,8-epoxyimidazo[1,2-a]azepine |
CAS name: | (5S,8R)-1-[(6-chloro-3-pyridinyl)methyl]-2,3,5,6,7,8-hexahydro-9-nitro-5,8-epoxy-1H-imidazo[1,2-a]azepine |
CAS Reg. No.: | 1203791-41-6 |
Formula: | C14H15ClN4O3 |
Activity: | insecticides (nitromethylene) |
Notes: | There is no ISO common name for this substance; the name “cycloxaprid” (环氧虫啶) is used in China. Some sources say that cycloxaprid is the other enantiomer, others say that it is the racemate. |
Structure: | |
Pronunciation: | sī-klǒks-a-prǐd Guide to British pronunciation |
InChIKey: | NDHXMRFNYMNBKO-PWSUYJOCSA-N |
InChI: | InChI=1S/C14H15ClN4O3/c15-11-3-1-9(7-16-11)8-17-5-6-18-12-4-2-10(22-12)13(14(17)18)19(20)21/h1,3,7,10,12H,2,4-6,8H2/t10-,12+/m1/s1 |
A data sheet from the Compendium of Pesticide Common Names