Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | potassium 4-(2,4-dichlorophenoxy)butanoate |
IUPAC name: | potassium 4-(2,4-dichlorophenoxy)butyrate |
CAS name: | potassium 4-(2,4-dichlorophenoxy)butanoate |
CAS Reg. No.: | 19480-40-1 |
Formula: | C10H9Cl2KO3 |
Activity: | herbicides (phenoxybutyric) |
Notes: | This substance is a derivative of 2,4-DB [94-82-6]. |
Structure: | |
Pronunciation: | too for dē bē pa-tǎs-ē-am Guide to British pronunciation |
InChIKey: | WRBJKRRJBCSNLE-UHFFFAOYSA-M |
InChI: | InChI=1S/C10H10Cl2O3.K/c11-7-3-4-9(8(12)6-7)15-5-1-2-10(13)14;/h3-4,6H,1-2,5H2,(H,13,14);/q;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names