Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | 2,6-dibromo-4-cyanophenyl butanoate |
IUPAC name: | 2,6-dibromo-4-cyanophenyl butyrate |
CAS name: | 2,6-dibromo-4-cyanophenyl butanoate |
CAS Reg. No.: | 3861-41-4 |
Formula: | C11H9Br2NO2 |
Activity: | herbicides (hydroxybenzonitrile) |
Notes: | This substance is a derivative of bromoxynil [1689-84-5]. |
Structure: | |
Pronunciation: | brō-mǒks-ǐ-nǐl bū-tǐ-rāt Guide to British pronunciation |
InChIKey: | PGMZYNZXIYOOHJ-UHFFFAOYSA-N |
InChI: | InChI=1S/C11H9Br2NO2/c1-2-3-10(15)16-11-8(12)4-7(6-14)5-9(11)13/h4-5H,2-3H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names