Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | sodium 3,6-dichloro-2-methoxybenzoate |
IUPAC name: | sodium 3,6-dichloro-o-anisate or sodium 3,6-dichloro-2-methoxybenzoate |
CAS name: | sodium 3,6-dichloro-2-methoxybenzoate |
CAS Reg. No.: | 1982-69-0 |
Formula: | C8H5Cl2NaO3 |
Activity: | herbicides (benzoic acid) |
Notes: | This substance is a derivative of dicamba [1918-00-9]. |
Structure: | |
Pronunciation: | dī-kǎm-ba sō-dē-am Guide to British pronunciation |
InChIKey: | HLZCHRAMVPCKDU-UHFFFAOYSA-M |
InChI: | InChI=1S/C8H6Cl2O3.Na/c1-13-7-5(10)3-2-4(9)6(7)8(11)12;/h2-3H,1H3,(H,11,12);/q;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names