Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | potassium (2R)-2-(2,4-dichlorophenoxy)propanoate |
IUPAC name: | potassium (2R)-2-(2,4-dichlorophenoxy)propionate |
CAS name: | potassium (2R)-2-(2,4-dichlorophenoxy)propanoate |
CAS Reg. No.: | 113963-87-4 |
Formula: | C9H7Cl2KO3 |
Activity: | herbicides (phenoxypropionic) plant growth regulators (auxin) |
Notes: | This substance is a derivative of dichlorprop-P [15165-67-0]. The unresolved enantiomeric mixture of this substance has the ISO common name dichlorprop-potassium [5746-17-8]. |
Structure: | |
Pronunciation: | dī-klor-prǒp pē pa-tǎs-ē-am Guide to British pronunciation |
InChIKey: | SIVJKMBJGCUUNS-NUBCRITNSA-M |
InChI: | InChI=1S/C9H8Cl2O3.K/c1-5(9(12)13)14-8-3-2-6(10)4-7(8)11;/h2-5H,1H3,(H,12,13);/q;+1/p-1/t5-;/m1./s1 |
A data sheet from the Compendium of Pesticide Common Names