Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | 1,1′-bis[2-(diethylamino)-2-oxoethyl]-[4,4′-bipyridine]-1,1′-diium dichloride |
IUPAC name: | 1,1′-bis[(diethylcarbamoyl)methyl]-4,4′-bipyridinium dichloride or 1,1′-bis[(diethylcarbamoyl)methyl]-4,4′-bipyridyl-1,1′-diylium dichloride |
CAS name: | 1,1′-bis[2-(diethylamino)-2-oxoethyl]-4,4′-bipyridinium dichloride |
CAS Reg. No.: | 4029-02-1 |
Formula: | C22H32Cl2N4O2 |
Activity: | herbicides (quaternary ammonium) |
Notes: | This substance is a derivative of diethamquat [400852-67-7]. |
Structure: | |
Pronunciation: | dī-ēth-ǎm-kwǒt dī-klor-īd Guide to British pronunciation |
InChIKey: | BHEFMWJUXJLZSI-UHFFFAOYSA-L |
InChI: | InChI=1S/C22H32N4O2.2ClH/c1-5-25(6-2)21(27)17-23-13-9-19(10-14-23)20-11-15-24(16-12-20)18-22(28)26(7-3)8-4;;/h9-16H,5-8,17-18H2,1-4H3;2*1H/q+2;;/p-2 |
A data sheet from the Compendium of Pesticide Common Names