Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | 2-cyclohexyl-4,6-dinitrophenol—N-cyclohexylcyclohexan-1-amine (1/1) |
IUPAC name: | 2-cyclohexyl-4,6-dinitrophenol - dicyclohexylamine (1:1) or dicyclohexylammonium 2-cyclohexyl-4,6-dinitrophenolate |
CAS name: | 2-cyclohexyl-4,6-dinitrophenol compound with N-cyclohexylcyclohexanamine (1:1) |
CAS Reg. No.: | 317-83-9 |
Formula: | C24H37N3O5 |
Activity: | acaricides (dinitrophenol) insecticides (dinitrophenol) |
Notes: | This substance is a derivative of dinex [131-89-5]. |
Structure: | |
Pronunciation: | dī-něks dī-klěks-ēn Guide to British pronunciation |
InChIKey: | MZEVGJJYKJDFQA-UHFFFAOYSA-N |
InChI: | InChI=1S/C12H14N2O5.C12H23N/c15-12-10(8-4-2-1-3-5-8)6-9(13(16)17)7-11(12)14(18)19;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h6-8,15H,1-5H2;11-13H,1-10H2 |
A data sheet from the Compendium of Pesticide Common Names