Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | rac-potassium (2R)-2-(2,4,5-trichlorophenoxy)propanoate |
IUPAC name: | potassium (RS)-2-(2,4,5-trichlorophenoxy)propionate |
CAS name: | potassium 2-(2,4,5-trichlorophenoxy)propanoate |
CAS Reg. No.: | 2818-16-8 |
Formula: | C9H6Cl3KO3 |
Activity: | herbicides (phenoxypropionic) plant growth regulators (auxin) |
Notes: | This substance is a derivative of fenoprop [93-72-1]. |
Structure: | |
Pronunciation: | fěn-ō-prǒp pa-tǎs-ē-am Guide to British pronunciation |
InChIKey: | UGXBNNSVMGXPQG-UHFFFAOYSA-M |
InChI: | InChI=1S/C9H7Cl3O3.K/c1-4(9(13)14)15-8-3-6(11)5(10)2-7(8)12;/h2-4H,1H3,(H,13,14);/q;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names