Status: | modified ISO 1750 (published) |
---|---|
IUPAC name: | 4-{[(EZ)-(dimethylamino)methylene]amino}-m-tolyl methylcarbamate hydrochloride |
CAS name: | N,N-dimethyl-N′-[2-methyl-4-[[(methylamino)carbonyl]oxy]phenyl]methanimidamide hydrochloride (1:1) |
CAS Reg. No.: | 35452-92-7 |
Formula: | C12H18ClN3O2 |
Activity: | acaricides (carbamate) insecticides (carbamate) |
Notes: | This substance is a derivative of formparanate [17702-57-7]. |
Structure: | |
Pronunciation: | form-pǎr-a-nāt hī-drō-klor-ǐd Guide to British pronunciation |
InChIKey: | SDIUYIZASVDZKT-UHFFFAOYSA-N |
InChI: | InChI=1S/C12H17N3O2.ClH/c1-9-7-10(17-12(16)13-2)5-6-11(9)14-8-15(3)4;/h5-8H,1-4H3,(H,13,16);1H |
A data sheet from the Compendium of Pesticide Common Names