Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | sodium (4-chloro-2-methylphenoxy)acetate |
IUPAC name: | sodium [(4-chloro-o-tolyl)oxy]acetate |
CAS name: | sodium 2-(4-chloro-2-methylphenoxy)acetate |
CAS Reg. No.: | 3653-48-3 |
Formula: | C9H8ClNaO3 |
Activity: | herbicides (phenoxyacetic) |
Notes: | This substance is a derivative of MCPA [94-74-6]. |
Structure: | |
Pronunciation: | ěm sē pē ā sō-dē-am Guide to British pronunciation |
InChIKey: | STAPBGVGYWCRTF-UHFFFAOYSA-M |
InChI: | InChI=1S/C9H9ClO3.Na/c1-6-4-7(10)2-3-8(6)13-5-9(11)12;/h2-4H,5H2,1H3,(H,11,12);/q;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names