Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | potassium (2R)-2-(4-chloro-2-methylphenoxy)propanoate |
IUPAC name: | potassium (R)-2-[(4-chloro-o-tolyl)oxy]propionate |
CAS name: | potassium (2R)-2-(4-chloro-2-methylphenoxy)propanoate |
CAS Reg. No.: | 66423-05-0 |
Formula: | C10H10ClKO3 |
Activity: | herbicides (phenoxypropionic) |
Notes: | This substance is a derivative of mecoprop-P [16484-77-8]. The unresolved enantiomeric mixture of this substance has the ISO common name mecoprop-potassium [1929-86-8]. |
Structure: | |
Pronunciation: | měk-o-prǒp pē pa-tǎs-ē-am Guide to British pronunciation |
InChIKey: | OFCQYQOZASISIU-OGFXRTJISA-M |
InChI: | InChI=1S/C10H11ClO3.K/c1-6-5-8(11)3-4-9(6)14-7(2)10(12)13;/h3-5,7H,1-2H3,(H,12,13);/q;+1/p-1/t7-;/m1./s1 |
A data sheet from the Compendium of Pesticide Common Names