| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC PIN: | rac-potassium (2R)-2-(4-chloro-2-methylphenoxy)propanoate |
| IUPAC name: | potassium (RS)-2-[(4-chloro-o-tolyl)oxy]propionate |
| CAS name: | potassium 2-(4-chloro-2-methylphenoxy)propanoate |
| CAS Reg. No.: | 1929-86-8 |
| Formula: | C10H10ClKO3 |
| Activity: | herbicides (phenoxypropionic) |
| Notes: | This substance is a derivative of mecoprop [93-65-2]. The (+)-enantiomer of this substance has the ISO common name mecoprop-P-potassium [66423-05-0]. |
| Structure: |  |
| Pronunciation: | měk-o-prǒp pa-tǎs-ē-am Guide to British pronunciation |
| InChIKey: | OFCQYQOZASISIU-UHFFFAOYSA-M |
| InChI: | InChI=1S/C10H11ClO3.K/c1-6-5-8(11)3-4-9(6)14-7(2)10(12)13;/h3-5,7H,1-2H3,(H,12,13);/q;+1/p-1 |