methyl 2,5-dichlorobenzoate

Chinese: French:   Russian:


Status: none
IUPAC PIN: methyl 2,5-dichlorobenzoate
IUPAC name: methyl 2,5-dichlorobenzoate
CAS name: methyl 2,5-dichlorobenzoate
CAS Reg. No.: 2905-69-3
Formula: C8H6Cl2O2
Activity: fungicides (unclassified fungicides)
plant growth regulators (unclassified plant growth regulators)
Notes: This substance is a derivative of 2,5-dichlorobenzoic acid [50-70-3].
Structure: methyl 2,5-dichlorobenzoate
Pronunciation:  Guide to British pronunciation
InChIKey: SPJQBGGHUDNAIC-UHFFFAOYSA-N
InChI: InChI=1S/C8H6Cl2O2/c1-12-8(11)6-4-5(9)2-3-7(6)10/h2-4H,1H3

A data sheet from the Compendium of Pesticide Common Names