Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | methyl 2-[(4,6-dimethoxypyrimidin-2-yl)oxy]-6-[(1Ξ)-N-methoxyethanimidoyl]benzoate |
IUPAC name: | methyl (EZ)-2-[(4,6-dimethoxypyrimidin-2-yl)oxy]-6-[1-(methoxyimino)ethyl]benzoate |
CAS name: | methyl 2-[(4,6-dimethoxy-2-pyrimidinyl)oxy]-6-[1-(methoxyimino)ethyl]benzoate |
CAS Reg. No.: | 136191-64-5 |
Formula: | C17H19N3O6 |
Activity: | herbicides (pyrimidinyl benzoate) |
Notes: | This substance is a derivative of pyriminobac [136191-56-5]. |
Structure: | |
Pronunciation: | pǐ-rǐ-mēn-ō-bǎk mē-thīl Guide to British pronunciation |
InChIKey: | USSIUIGPBLPCDF-UHFFFAOYSA-N |
InChI: | InChI=1S/C17H19N3O6/c1-10(20-25-5)11-7-6-8-12(15(11)16(21)24-4)26-17-18-13(22-2)9-14(19-17)23-3/h6-9H,1-5H3 |
A data sheet from the Compendium of Pesticide Common Names