Approval: | ISO |
---|---|
IUPAC PIN: | (2R)-2-(2,4-dichlorophenoxy)propanoic acid |
IUPAC name: | (2R)-2-(2,4-dichlorophenoxy)propanoic acid 1979 Rules: (R)-2-(2,4-dichlorophenoxy)propionic acid |
CAS name: | (2R)-2-(2,4-dichlorophenoxy)propanoic acid |
CAS Reg. No.: | 15165-67-0 |
Formula: | C9H8Cl2O3 |
Activity: | herbicides (phenoxypropionic) |
Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example dichlorprop-P-dimethylammonium [104786-87-0], dichlorprop-P-etexyl [865363-39-9], dichlorprop-P-potassium [113963-87-4], dichlorprop-P-sodium [119299-10-4]. The unresolved enantiomeric mixture of this substance has the common name dichlorprop [120-36-5]. |
Structure: | |
Pronunciation: | dī-klor-prǒp pē Guide to British pronunciation |
InChIKey: | MZHCENGPTKEIGP-RXMQYKEDSA-N |
InChI: | InChI=1S/C9H8Cl2O3/c1-5(9(12)13)14-8-3-2-6(10)4-7(8)11/h2-5H,1H3,(H,12,13)/t5-/m1/s1 |
A data sheet from the Compendium of Pesticide Common Names