Approval: | ISO |
---|---|
IUPAC PIN: | 6-(3,5-dichloro-4-methylphenyl)pyridazin-3(2H)-one |
IUPAC name: | 6-(3,5-dichloro-4-methylphenyl)pyridazin-3(2H)-one 1979 Rules: 6-(3,5-dichloro-p-tolyl)pyridazin-3(2H)-one |
CAS name: | 6-(3,5-dichloro-4-methylphenyl)-3(2H)-pyridazinone |
CAS Reg. No.: | 62865-36-5 |
Formula: | C11H8Cl2N2O |
Activity: | fungicides (pyridazinone) |
Notes: | When this substance is used as a salt, its identity should be stated, for example diclomezine-sodium [62902-57-2]. |
Structure: | |
Pronunciation: | dī-klō-mě-zēn Guide to British pronunciation |
InChIKey: | UWQMKVBQKFHLCE-UHFFFAOYSA-N |
InChI: | InChI=1S/C11H8Cl2N2O/c1-6-8(12)4-7(5-9(6)13)10-2-3-11(16)15-14-10/h2-5H,1H3,(H,15,16) |
A data sheet from the Compendium of Pesticide Common Names