Status: | ESA |
---|---|
IUPAC PIN: | 5,5-dimethyl-3-oxocyclohex-1-en-1-yl dimethylcarbamate |
IUPAC name: | 5,5-dimethyl-3-oxocyclohex-1-en-1-yl dimethylcarbamate |
CAS name: | 5,5-dimethyl-3-oxo-1-cyclohexen-1-yl N,N-dimethylcarbamate |
CAS Reg. No.: | 122-15-6 |
Formula: | C11H17NO3 |
Activity: | insecticides (dimethylcarbamate insecticides) |
Notes: | There is no ISO common name for this substance; the name “dimetan” is approved by the Entomological Society of America, and is also approved in China (地麦威). |
Structure: | |
Pronunciation: | dī-mē-tǎn Guide to British pronunciation |
InChIKey: | ITEQSCBLCCNACE-UHFFFAOYSA-N |
InChI: | InChI=1S/C11H17NO3/c1-11(2)6-8(13)5-9(7-11)15-10(14)12(3)4/h5H,6-7H2,1-4H3 |
A data sheet from the Compendium of Pesticide Common Names