Approval: | ISO |
---|---|
IUPAC PIN: | 5-butyl-2-(dimethylamino)-6-methylpyrimidin-4-ol |
IUPAC name: | 5-butyl-2-(dimethylamino)-6-methylpyrimidin-4-ol |
CAS name: | 5-butyl-2-(dimethylamino)-6-methyl-4(1H)-pyrimidinone |
CAS Reg. No.: | 5221-53-4 |
Formula: | C11H19N3O |
Activity: | fungicides (aminopyrimidinol) |
Notes: | The IUPAC name and the structural formula correspond to the information provided by the manufacturer. The CAS name and Registry Number are for the tautomer that is preferred under the CAS nomenclature rules. |
Structure: | |
Pronunciation: | dī-mě-thǐr-ǐ-mǒl Guide to British pronunciation |
InChIKey: | CJHXCRMKMMBYJQ-UHFFFAOYSA-N |
InChI: | InChI=1S/C11H19N3O/c1-5-6-7-9-8(2)12-11(14(3)4)13-10(9)15/h5-7H2,1-4H3,(H,12,13,15) |
A data sheet from the Compendium of Pesticide Common Names