Approval: | ISO |
---|---|
IUPAC PIN: | 2-cyclohexyl-4,6-dinitrophenol |
IUPAC name: | 2-cyclohexyl-4,6-dinitrophenol |
CAS name: | 2-cyclohexyl-4,6-dinitrophenol |
CAS Reg. No.: | 131-89-5 |
Formula: | C12H14N2O5 |
Activity: | acaricides (dinitrophenol) insecticides (dinitrophenol) |
Notes: | * The name “pédinex” (n.m.) is used in France. When this substance is used as a salt, its identity should be stated, for example dinex-diclexine [317-83-9]. |
Structure: | |
Pronunciation: | dī-něks Guide to British pronunciation |
InChIKey: | QJYHUJAGJUHXJN-UHFFFAOYSA-N |
InChI: | InChI=1S/C12H14N2O5/c15-12-10(8-4-2-1-3-5-8)6-9(13(16)17)7-11(12)14(18)19/h6-8,15H,1-5H2 |
A data sheet from the Compendium of Pesticide Common Names