| Status: | WHO INN |
|---|---|
| IUPAC PIN: | N1,N1,N3,N3-tetraethyl-2-(dithioperoxy)-1,3-dithiodicarbonic diamide |
| IUPAC name: | tetraethylthiuram disulfide |
| CAS name: | tetraethylthioperoxydicarbonic diamide ([[(C2H5)2N]C(S)]2S2) |
| CAS Reg. No.: | 97-77-8 |
| Formula: | C10H20N2S4 |
| Activity: | acaricides (dithiocarbamate) fungicides (dithiocarbamate) |
| Notes: | There is no ISO common name for this substance; the name “disulfiram” is approved by the World Health Organization. |
| Structure: |  |
| Pronunciation: | dī-sǔl-fǐ-rǎm Guide to British pronunciation |
| InChIKey: | AUZONCFQVSMFAP-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H20N2S4/c1-5-11(6-2)9(13)15-16-10(14)12(7-3)8-4/h5-8H2,1-4H3 |