Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | (Ξ)-cyano(3-phenoxyphenyl)methyl (2Ξ)-2-(4-chlorophenyl)-3-methylbutanoate |
IUPAC name: | (αRS)-α-cyano-3-phenoxybenzyl (2RS)-2-(4-chlorophenyl)-3-methylbutanoate 1979 Rules: (RS)-α-cyano-3-phenoxybenzyl (RS)-2-(4-chlorophenyl)-3-methylbutyrate |
CAS name: | cyano(3-phenoxyphenyl)methyl 4-chloro-α-(1-methylethyl)benzeneacetate |
CAS Reg. No.: | 51630-58-1 |
Formula: | C25H22ClNO3 |
Activity: | acaricides (pyrethroid isovalerate ester) insecticides (pyrethroid isovalerate ester) |
Notes: | One isomer of this substance has its own ISO common name; see esfenvalerate [66230-04-4]. |
Structure: | |
Pronunciation: | fěn-vǎl-er-āt Guide to British pronunciation |
InChIKey: | NYPJDWWKZLNGGM-UHFFFAOYSA-N |
InChI: | InChI=1S/C25H22ClNO3/c1-17(2)24(18-11-13-20(26)14-12-18)25(28)30-23(16-27)19-7-6-10-22(15-19)29-21-8-4-3-5-9-21/h3-15,17,23-24H,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names