| Approval: | ISO |
|---|---|
| IUPAC PIN: | (1Ξ,2Ξ,3Ξ,4Ξ,5Ξ,6Ξ)-1,2,3,4,5,6-hexachlorocyclohexane |
| IUPAC name: | 1,2,3,4,5,6-hexachlorocyclohexane |
| CAS name: | 1,2,3,4,5,6-hexachlorocyclohexane |
| CAS Reg. No.: | 608-73-1 |
| Formula: | C6H6Cl6 |
| Activity: | insecticides (organochlorine) |
| Notes: | The common name “BHC” was formerly approved by ISO for this substance, but this name was withdrawn. The name “benzene hexachloride” is used in the USA; the name “hexachlor” is used in Sweden; the name “hexachloran” (гексахлоран) was used in the former USSR. The ISO common name for the γ-isomer is gamma-HCH [58-89-9]. |
| Structure: |  |
| Pronunciation: | āch sē āch Guide to British pronunciation |
| InChIKey: | JLYXXMFPNIAWKQ-UHFFFAOYSA-N |
| InChI: | InChI=1S/C6H6Cl6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-6H |