Approval: | ISO |
---|---|
IUPAC PIN: | 1,1-dimethylpiperidin-1-ium |
IUPAC name: | 1,1-dimethylpiperidinium |
CAS name: | 1,1-dimethylpiperidinium |
CAS Reg. No.: | 15302-91-7 |
Formula: | C7H16N |
Activity: | plant growth regulators (growth inhibitor) |
Notes: | When this substance is used as a salt, its identity should be stated, for example mepiquat chloride [24307-26-4], mepiquat pentaborate [245735-90-4]. |
Structure: | |
Pronunciation: | mě-pǐ-kwǒt Guide to British pronunciation |
InChIKey: | NNCAWEWCFVZOGF-UHFFFAOYSA-N |
InChI: | InChI=1S/C7H16N/c1-8(2)6-4-3-5-7-8/h3-7H2,1-2H3/q+1 |
A data sheet from the Compendium of Pesticide Common Names