Status: | WHO INN |
---|---|
IUPAC PIN: | 2,7-dimethylthianthrene |
IUPAC name: | 2,7-dimethylthianthrene |
CAS name: | 2,7-dimethylthianthrene |
CAS Reg. No.: | 135-58-0 |
Formula: | C14H12S2 |
Activity: | acaricides (unclassified acaricides) |
Notes: | There is no ISO common name for this substance; the name “mesulfen” is approved by the World Health Organization and the name “mesulphen” was formerly approved by the British Pharmacopoeia Commission. |
Structure: | |
Pronunciation: | mē-sǔl-fěn Guide to British pronunciation |
InChIKey: | AHXDSVSZEZHDLV-UHFFFAOYSA-N |
InChI: | InChI=1S/C14H12S2/c1-9-3-5-11-13(7-9)15-12-6-4-10(2)8-14(12)16-11/h3-8H,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names