Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | 2,4-dichloro-1-(4-nitrophenoxy)benzene |
IUPAC name: | 2,4-dichlorophenyl 4-nitrophenyl ether |
CAS name: | 2,4-dichloro-1-(4-nitrophenoxy)benzene |
CAS Reg. No.: | 1836-75-5 |
Formula: | C12H7Cl2NO3 |
Activity: | herbicides (diphenyl ether) |
Notes: | The name “NIP” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries, and the name “niclofen” is used in Canada. |
Structure: | |
Pronunciation: | nī-trō-fěn Guide to British pronunciation |
InChIKey: | XITQUSLLOSKDTB-UHFFFAOYSA-N |
InChI: | InChI=1S/C12H7Cl2NO3/c13-8-1-6-12(11(14)7-8)18-10-4-2-9(3-5-10)15(16)17/h1-7H |
A data sheet from the Compendium of Pesticide Common Names