Status: | none |
---|---|
IUPAC PIN: | rac-(2R)-2-chloro-3-(3-chloro-2-methylphenyl)propanenitrile |
IUPAC name: | (2RS)-2-chloro-3-(3-chloro-2-methylphenyl)propanenitrile 1979 Rules: (2RS)-2-chloro-3-(3-chloro-o-tolyl)propiononitrile |
CAS name: | α,3-dichloro-2-methylbenzenepropanenitrile |
CAS Reg. No.: | 21342-85-8 |
Formula: | C10H8Cl2N |
Activity: | plant growth regulators (auxin) |
Notes: | There is no ISO common name for this substance; the name “orthonil” has been used in the literature, but it has no official status. |
Structure: | |
Pronunciation: | ǒrth-ō-nǐl Guide to British pronunciation |
InChIKey: | YYJUXSGXHHPBTK-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H9Cl2N/c1-7-8(5-9(11)6-13)3-2-4-10(7)12/h2-4,9H,5H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names