Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | 1,1′-dimethyl-[4,4′-bipyridine]-1,1′-diium |
IUPAC name: | 1,1′-dimethyl-4,4′-bipyridinium |
CAS name: | 1,1′-dimethyl-4,4′-bipyridinium |
CAS Reg. No.: | 4685-14-7 |
Formula: | C12H14N2 |
Activity: | herbicides (quaternary ammonium) |
Notes: | When this substance is used as a salt, its identity should be stated, for example paraquat dichloride [1910-42-5], paraquat dimetilsulfate [2074-50-2]. |
Structure: | |
Pronunciation: | pǎr-a-kwǒt Guide to British pronunciation |
InChIKey: | INFDPOAKFNIJBF-UHFFFAOYSA-N |
InChI: | InChI=1S/C12H14N2/c1-13-7-3-11(4-8-13)12-5-9-14(2)10-6-12/h3-10H,1-2H3/q+2 |
A data sheet from the Compendium of Pesticide Common Names