Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | 3,4-dimethyl-2,6-dinitro-N-pentan-3-ylaniline |
IUPAC name: | N-(1-ethylpropyl)-3,4-dimethyl-2,6-dinitroaniline 1979 Rules: N-(1-ethylpropyl)-2,6-dinitro-3,4-xylidine |
CAS name: | N-(1-ethylpropyl)-3,4-dimethyl-2,6-dinitrobenzenamine |
CAS Reg. No.: | 40487-42-1 |
Formula: | C13H19N3O4 |
Activity: | herbicides (dinitroaniline) |
Notes: | The name “penoxalin” has been used in the literature, but it has no official status. |
Structure: | |
Pronunciation: | pěn-dī-měth-a-lǐn Guide to British pronunciation |
InChIKey: | CHIFOSRWCNZCFN-UHFFFAOYSA-N |
InChI: | InChI=1S/C13H19N3O4/c1-5-10(6-2)14-12-11(15(17)18)7-8(3)9(4)13(12)16(19)20/h7,10,14H,5-6H2,1-4H3 |
A data sheet from the Compendium of Pesticide Common Names