Status: | none |
---|---|
IUPAC PIN: | 5-{[(but-2-yn-1-yl)oxy]methyl}-2H-1,3-benzodioxole |
IUPAC name: | 1,3-benzodioxol-5-ylmethyl but-2-ynyl ether 1979 Rules: but-2-ynyl piperonyl ether |
CAS name: | 5-[(2-butynyloxy)methyl]-1,3-benzodioxole |
CAS Reg. No.: | |
Formula: | C12H12O3 |
Activity: | synergists |
Notes: | There is no ISO common name for this substance; the name “perbutin” has been used in the literature but it has no official status. |
Structure: | |
Pronunciation: | Guide to British pronunciation |
InChIKey: | JGRBQLMBYFIVEZ-UHFFFAOYSA-N |
InChI: | InChI=1S/C12H12O3/c1-2-3-6-13-8-10-4-5-11-12(7-10)15-9-14-11/h4-5,7H,6,8-9H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names