Status: | ISO 765 (published) |
---|---|
IUPAC PIN: | 5-{[2-(2-butoxyethoxy)ethoxy]methyl}-6-propyl-2H-1,3-benzodioxole |
IUPAC name: | 5-[2-(2-butoxyethoxy)ethoxymethyl]-6-propyl-1,3-benzodioxole 1979 Rules: 2-(2-butoxyethoxy)ethyl 6-propylpiperonyl ether |
CAS name: | 5-[[2-(2-butoxyethoxy)ethoxy]methyl]-6-propyl-1,3-benzodioxole |
CAS Reg. No.: | 51-03-6 |
Formula: | C19H30O5 |
Activity: | synergists |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | pǐ-pěr-ō-nīl bū-tǒks-īd Guide to British pronunciation |
InChIKey: | FIPWRIJSWJWJAI-UHFFFAOYSA-N |
InChI: | InChI=1S/C19H30O5/c1-3-5-7-20-8-9-21-10-11-22-14-17-13-19-18(23-15-24-19)12-16(17)6-4-2/h12-13H,3-11,14-15H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names