Status: | China |
---|---|
IUPAC PIN: | 6-methyl-2-propylpyrimidin-4-yl dimethylcarbamate |
IUPAC name: | 6-methyl-2-propylpyrimidin-4-yl dimethylcarbamate |
CAS name: | 6-methyl-2-propyl-4-pyrimidinyl N,N-dimethylcarbamate |
CAS Reg. No.: | 2532-49-2 |
Formula: | C11H17N3O2 |
Activity: | insecticides (dimethylcarbamate) |
Notes: | There is no ISO common name for this substance; the name “pyramat” (嘧啶威) is approved in China, even though Pyramat is (or was) a registered trade mark in many countries. |
Structure: | |
Pronunciation: | pīr-a-mǎt Guide to British pronunciation |
InChIKey: | HRLNKILMCKNVPD-UHFFFAOYSA-N |
InChI: | InChI=1S/C11H17N3O2/c1-5-6-9-7-10(13-8(2)12-9)16-11(15)14(3)4/h7H,5-6H2,1-4H3 |
A data sheet from the Compendium of Pesticide Common Names