Status: | WSSA |
---|---|
IUPAC PIN: | 2,3,5-trichloropyridin-4-ol |
IUPAC name: | 2,3,5-trichloropyridin-4-ol |
CAS name: | 2,3,5-trichloro-4-pyridinol |
CAS Reg. No.: | 1970-40-7 |
Formula: | C5H2Cl3NO |
Activity: | herbicides (pyridinol) |
Notes: | There is no ISO common name for this substance; the name “pyriclor” is approved by the Weed Science Society of America. |
Structure: | |
Pronunciation: | pǐr-ǐ-klor Guide to British pronunciation |
InChIKey: | XTVIFVALDYTCLL-UHFFFAOYSA-N |
InChI: | InChI=1S/C5H2Cl3NO/c6-2-1-9-5(8)3(7)4(2)10/h1H,(H,9,10) |
A data sheet from the Compendium of Pesticide Common Names