Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | 2-[(4,6-dimethoxypyrimidin-2-yl)oxy]-6-[(1Ξ)-N-methoxyethanimidoyl]benzoic acid |
IUPAC name: | (EZ)-2-[(4,6-dimethoxypyrimidin-2-yl)oxy]-6-[1-(methoxyimino)ethyl]benzoic acid |
CAS name: | 2-[(4,6-dimethoxy-2-pyrimidinyl)oxy]-6-[1-(methoxyimino)ethyl]benzoic acid |
CAS Reg. No.: | 136191-56-5 |
Formula: | C16H17N3O6 |
Activity: | herbicides (pyrimidinyl benzoate) |
Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example pyriminobac-methyl [136191-64-5]. |
Structure: | |
Pronunciation: | pǐ-rǐ-mēn-ō-bǎk Guide to British pronunciation |
InChIKey: | DEIKMOQTJBGGAX-UHFFFAOYSA-N |
InChI: | InChI=1S/C16H17N3O6/c1-9(19-24-4)10-6-5-7-11(14(10)15(20)21)25-16-17-12(22-2)8-13(18-16)23-3/h5-8H,1-4H3,(H,20,21) |
A data sheet from the Compendium of Pesticide Common Names