Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | 2,3,5-trichloro-6-methoxybenzoic acid |
IUPAC name: | 2,3,5-trichloro-6-methoxybenzoic acid 1979 Rules: 3,5,6-trichloro-o-anisic acid |
CAS name: | 2,3,5-trichloro-6-methoxybenzoic acid |
CAS Reg. No.: | 2307-49-5 |
Formula: | C8H5Cl3O3 |
Activity: | herbicides (benzoic acid) |
Notes: | When this substance is used as an ester or a salt, its identity should be stated. |
Structure: | |
Pronunciation: | trī-kǎm-ba Guide to British pronunciation |
InChIKey: | WCLDITPGPXSPGV-UHFFFAOYSA-N |
InChI: | InChI=1S/C8H5Cl3O3/c1-14-7-4(10)2-3(9)6(11)5(7)8(12)13/h2H,1H3,(H,12,13) |
A data sheet from the Compendium of Pesticide Common Names